4-(methylthio)benzoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

p-methiobenzoic acid; 4-methylsulfanylbenzoic acid; p-(methylthio)benzoic acid; p-methylthiobenzoic acid; 4-(methylthio)benzoic acid
CAS RN:[13205-48-6]
Formula:C8H8O2S; 168.22 g/mol
InChiKey:KWHCPERWLHBLOT-UHFFFAOYSA-N
SMILES:CSc1ccc(cc1)C(O)=O
Molecular structure of 4-(methylthio)benzoic acid
Melting point:195 °C
Log10 partition octanol / water:2.74

Isomers

ethenylsulfonylbenzene
Molecular structure of ethenylsulfonylbenzene
4-mercaptophenylacetic acid
Molecular structure of 4-mercaptophenylacetic acid
methyl 4-sulfanylbenzoate
Molecular structure of methyl 4-sulfanylbenzoate
2-methylsulfanylbenzoic acid
Molecular structure of 2-methylsulfanylbenzoic acid
3-(methylthio)benzoic acid
Molecular structure of 3-(methylthio)benzoic acid
4-(methylthio)benzoic acid
Molecular structure of 4-(methylthio)benzoic acid
methyl thiosalicylate
Molecular structure of methyl thiosalicylate
phenyl(sulfanyl)acetic acid
Molecular structure of phenyl(sulfanyl)acetic acid
2-phenylsulfanylacetic acid
Molecular structure of 2-phenylsulfanylacetic acid
  ::     ::   Zla Mavka